C18H43N3O3Si — CID 123680409
2-[bis[2-(diethylamino)ethoxy]silyloxy]-N,N-diethylethanamine (PubChem CID 123680409) has the molecular formula C18H43N3O3Si and a molecular weight of 377.65 g/mol. Its IUPAC name is 2-[bis[2-(diethylamino)ethoxy]silyloxy]-N,N-diethylethanamine.
| Compound Name | 2-[bis[2-(diethylamino)ethoxy]silyloxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 123680409 |
| Molecular Formula | C18H43N3O3Si |
| Molecular Weight | 377.65 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | 2-[bis[2-(diethylamino)ethoxy]silyloxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCO[SiH](OCCN(CC)CC)OCCN(CC)CC |
| InChI | InChI=1S/C18H43N3O3Si/c1-7-19(8-2)13-16-22-25(23-17-14-20(9-3)10-4)24-18-15-21(11-5)12-6/h25H,7-18H2,1-6H3 |
| InChIKey | DCKNATAMTSQCBL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.65 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|