C7H15I2NO — CID 166818774
2-(diiodomethoxy)-N,N-diethylethanamine (PubChem CID 166818774) has the molecular formula C7H15I2NO and a molecular weight of 383.01 g/mol. Its IUPAC name is 2-(diiodomethoxy)-N,N-diethylethanamine.
| Compound Name | 2-(diiodomethoxy)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 166818774 |
| Molecular Formula | C7H15I2NO |
| Molecular Weight | 383.01 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | 2-(diiodomethoxy)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOC(I)I |
| InChI | InChI=1S/C7H15I2NO/c1-3-10(4-2)5-6-11-7(8)9/h7H,3-6H2,1-2H3 |
| InChIKey | XEALFXKSWFNGSP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.01 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|