C6H15NOS — CID 141295772
N,N-diethyl-2-sulfanyloxyethanamine (PubChem CID 141295772) has the molecular formula C6H15NOS and a molecular weight of 149.26 g/mol. Its IUPAC name is N,N-diethyl-2-sulfanyloxyethanamine.
| Compound Name | N,N-diethyl-2-sulfanyloxyethanamine |
|---|---|
| PubChem CID | 141295772 |
| Molecular Formula | C6H15NOS |
| Molecular Weight | 149.26 g/mol |
| Exact Mass | 149.09 |
| IUPAC Name | N,N-diethyl-2-sulfanyloxyethanamine |
| SMILES | CCN(CC)CCOS |
| InChI | InChI=1S/C6H15NOS/c1-3-7(4-2)5-6-8-9/h9H,3-6H2,1-2H3 |
| InChIKey | ZGNRDHBMOCRTGT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|