About N,N-diethylethanamine;thallium(1+);hydroxide
N,N-diethylethanamine;thallium(1+);hydroxide (PubChem CID 174838347) has the molecular formula C6H16NOTl
and a molecular weight of 322.58 g/mol. Its IUPAC name is N,N-diethylethanamine;thallium(1+);hydroxide.
Molecular Properties
| Compound Name | N,N-diethylethanamine;thallium(1+);hydroxide |
| PubChem CID | 174838347 |
| Molecular Formula | C6H16NOTl |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N,N-diethylethanamine;thallium(1+);hydroxide |
| SMILES | CCN(CC)CC.[OH-].[Tl+] |
| InChI | InChI=1S/C6H15N.H2O.Tl/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;1H2;/q;;+1/p-1 |
| InChIKey | JWUKZHCKVVDIGG-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 33.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;thallium(1+);hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;thallium(1+);hydroxide?
The IUPAC name of N,N-diethylethanamine;thallium(1+);hydroxide (CID 174838347) is N,N-diethylethanamine;thallium(1+);hydroxide.
What is the SMILES notation for N,N-diethylethanamine;thallium(1+);hydroxide?
The canonical SMILES for N,N-diethylethanamine;thallium(1+);hydroxide is CCN(CC)CC.[OH-].[Tl+].
What is the InChIKey of N,N-diethylethanamine;thallium(1+);hydroxide?
The InChIKey is JWUKZHCKVVDIGG-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15N.H2O.Tl/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;1H2;/q;;+1/p-1.
What are the key properties of N,N-diethylethanamine;thallium(1+);hydroxide?
N,N-diethylethanamine;thallium(1+);hydroxide has a molecular weight of 322.58 g/mol, XLogP of 0.79, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;thallium(1+);hydroxide is sourced from PubChem (CID 174838347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).