C7H18N2O — CID 143582118
N,N-diethyl-2-(methylaminooxy)ethanamine (PubChem CID 143582118) has the molecular formula C7H18N2O and a molecular weight of 146.23 g/mol. Its IUPAC name is N,N-diethyl-2-(methylaminooxy)ethanamine.
| Compound Name | N,N-diethyl-2-(methylaminooxy)ethanamine |
|---|---|
| PubChem CID | 143582118 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | N,N-diethyl-2-(methylaminooxy)ethanamine |
| SMILES | CCN(CC)CCONC |
| InChI | InChI=1S/C7H18N2O/c1-4-9(5-2)6-7-10-8-3/h8H,4-7H2,1-3H3 |
| InChIKey | IUXXSBJKDIURQJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|