About 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile
2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile (PubChem CID 123244636) has the molecular formula C5H4N2O2S
and a molecular weight of 156.17 g/mol. Its IUPAC name is 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile |
| PubChem CID | 123244636 |
| Molecular Formula | C5H4N2O2S |
| Molecular Weight | 156.17 g/mol |
| Exact Mass | 156.00 |
| IUPAC Name | 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile |
| SMILES | N#CCn1c(O)csc1=O |
| InChI | InChI=1S/C5H4N2O2S/c6-1-2-7-4(8)3-10-5(7)9/h3,8H,2H2 |
| InChIKey | UXWOOWOSXDRPOV-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile?
The IUPAC name of 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile (CID 123244636) is 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile.
What is the SMILES notation for 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile?
The canonical SMILES for 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile is N#CCn1c(O)csc1=O.
What is the InChIKey of 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile?
The InChIKey is UXWOOWOSXDRPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2S/c6-1-2-7-4(8)3-10-5(7)9/h3,8H,2H2.
What are the key properties of 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile?
2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile has a molecular weight of 156.17 g/mol, XLogP of 0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-2-oxo-1,3-thiazol-3-yl)acetonitrile is sourced from PubChem (CID 123244636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).