C12H21N7 — CID 123246144
3-imino-3-(3-methylpiperazin-1-yl)-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide (PubChem CID 123246144) has the molecular formula C12H21N7 and a molecular weight of 263.35 g/mol. Its IUPAC name is 3-imino-3-(3-methylpiperazin-1-yl)-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide.
| Compound Name | 3-imino-3-(3-methylpiperazin-1-yl)-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
|---|---|
| PubChem CID | 123246144 |
| Molecular Formula | C12H21N7 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 3-imino-3-(3-methylpiperazin-1-yl)-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
| SMILES | [H]/N=C(\C/C(N)=N/c1cc(C)[nH]n1)N1CCNC(C)C1 |
| InChI | InChI=1S/C12H21N7/c1-8-5-12(18-17-8)16-10(13)6-11(14)19-4-3-15-9(2)7-19/h5,9,14-15H,3-4,6-7H2,1-2H3,(H3,13,16,17,18)/b14-11+ |
| InChIKey | FKIRIOGQQCVSAS-SDNWHVSQSA-N |
| XLogP | 0.37 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|