C13H14N2O3S — CID 123248487
1-acetamido-5-[(sulfinoamino)methyl]naphthalene (PubChem CID 123248487) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-acetamido-5-[(sulfinoamino)methyl]naphthalene.
| Compound Name | 1-acetamido-5-[(sulfinoamino)methyl]naphthalene |
|---|---|
| PubChem CID | 123248487 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-acetamido-5-[(sulfinoamino)methyl]naphthalene |
| SMILES | CC(=O)Nc1cccc2c(CNS(=O)O)cccc12 |
| InChI | InChI=1S/C13H14N2O3S/c1-9(16)15-13-7-3-5-11-10(8-14-19(17)18)4-2-6-12(11)13/h2-7,14H,8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | OHFVYTKFBCEVIZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|