C26H26N3+ — CID 123248779
17-cyclopentyl-3,5,21-trimethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene (PubChem CID 123248779) has the molecular formula C26H26N3+ and a molecular weight of 380.52 g/mol. Its IUPAC name is 17-cyclopentyl-3,5,21-trimethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene.
| Compound Name | 17-cyclopentyl-3,5,21-trimethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene |
|---|---|
| PubChem CID | 123248779 |
| Molecular Formula | C26H26N3+ |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 17-cyclopentyl-3,5,21-trimethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene |
| SMILES | Cc1cc(C)c2c(n1)c1ccccc1n1c3cc(C4CCCC4)ccc3[n+](C)c21 |
| InChI | InChI=1S/C26H26N3/c1-16-14-17(2)27-25-20-10-6-7-11-21(20)29-23-15-19(18-8-4-5-9-18)12-13-22(23)28(3)26(29)24(16)25/h6-7,10-15,18H,4-5,8-9H2,1-3H3/q+1 |
| InChIKey | KRHQIILQJYGJDH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|