C29H26N3+ — CID 123934587
17-(2,6-dimethylphenyl)-3,5,21-trimethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene (PubChem CID 123934587) has the molecular formula C29H26N3+ and a molecular weight of 416.55 g/mol. Its IUPAC name is 17-(2,6-dimethylphenyl)-3,5,21-trimethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene.
| Compound Name | 17-(2,6-dimethylphenyl)-3,5,21-trimethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene |
|---|---|
| PubChem CID | 123934587 |
| Molecular Formula | C29H26N3+ |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 17-(2,6-dimethylphenyl)-3,5,21-trimethyl-6,14-diaza-21-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8,10,12,15(20),16,18-decaene |
| SMILES | Cc1cc(C)c2c(n1)c1ccccc1n1c3cc(-c4c(C)cccc4C)ccc3[n+](C)c21 |
| InChI | InChI=1S/C29H26N3/c1-17-9-8-10-18(2)26(17)21-13-14-24-25(16-21)32-23-12-7-6-11-22(23)28-27(29(32)31(24)5)19(3)15-20(4)30-28/h6-16H,1-5H3/q+1 |
| InChIKey | CGYFEZOGQSRPOB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|