About (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane
(3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane (PubChem CID 123248787) has the molecular formula C21H36
and a molecular weight of 288.52 g/mol. Its IUPAC name is (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane.
Molecular Properties
| Compound Name | (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane |
| PubChem CID | 123248787 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane |
| SMILES | C=C(C)C(=CCCCC)C=C(C(C)CC)C(C)C1CCC1 |
| InChI | InChI=1S/C21H36/c1-7-9-10-12-20(16(3)4)15-21(17(5)8-2)18(6)19-13-11-14-19/h12,15,17-19H,3,7-11,13-14H2,1-2,4-6H3 |
| InChIKey | KPBLLIJVVHGDJP-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane?
The IUPAC name of (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane (CID 123248787) is (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane.
What is the SMILES notation for (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane?
The canonical SMILES for (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane is C=C(C)C(=CCCCC)C=C(C(C)CC)C(C)C1CCC1.
What is the InChIKey of (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane?
The InChIKey is KPBLLIJVVHGDJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36/c1-7-9-10-12-20(16(3)4)15-21(17(5)8-2)18(6)19-13-11-14-19/h12,15,17-19H,3,7-11,13-14H2,1-2,4-6H3.
What are the key properties of (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane?
(3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane has a molecular weight of 288.52 g/mol, XLogP of 7.09, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butan-2-yl-5-prop-1-en-2-yldeca-3,5-dien-2-yl)cyclobutane is sourced from PubChem (CID 123248787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).