C16H31BO2 — CID 134897628
[(4E)-2-methylnona-1,4-dien-4-yl]-di(propan-2-yloxy)borane (PubChem CID 134897628) has the molecular formula C16H31BO2 and a molecular weight of 266.23 g/mol. Its IUPAC name is [(4E)-2-methylnona-1,4-dien-4-yl]-di(propan-2-yloxy)borane.
| Compound Name | [(4E)-2-methylnona-1,4-dien-4-yl]-di(propan-2-yloxy)borane |
|---|---|
| PubChem CID | 134897628 |
| Molecular Formula | C16H31BO2 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | [(4E)-2-methylnona-1,4-dien-4-yl]-di(propan-2-yloxy)borane |
| SMILES | C=C(C)C/C(=C/CCCC)B(OC(C)C)OC(C)C |
| InChI | InChI=1S/C16H31BO2/c1-8-9-10-11-16(12-13(2)3)17(18-14(4)5)19-15(6)7/h11,14-15H,2,8-10,12H2,1,3-7H3/b16-11- |
| InChIKey | GKHITPCCSUFZGC-WJDWOHSUSA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|