C67H50N3O+ — CID 123248998
[2-[3,5-bis(7,7-dimethyl-5-phenylindeno[2,1-b]carbazol-2-yl)phenyl]phenyl]-methyl-oxoazanium (PubChem CID 123248998) has the molecular formula C67H50N3O+ and a molecular weight of 913.16 g/mol. Its IUPAC name is [2-[3,5-bis(7,7-dimethyl-5-phenylindeno[2,1-b]carbazol-2-yl)phenyl]phenyl]-methyl-oxoazanium.
| Compound Name | [2-[3,5-bis(7,7-dimethyl-5-phenylindeno[2,1-b]carbazol-2-yl)phenyl]phenyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 123248998 |
| Molecular Formula | C67H50N3O+ |
| Molecular Weight | 913.16 g/mol |
| Exact Mass | 912.39 |
| IUPAC Name | [2-[3,5-bis(7,7-dimethyl-5-phenylindeno[2,1-b]carbazol-2-yl)phenyl]phenyl]-methyl-oxoazanium |
| SMILES | C[N+](=O)c1ccccc1-c1cc(-c2ccc3c(c2)c2cc4c(cc2n3-c2ccccc2)C(C)(C)c2ccccc2-4)cc(-c2ccc3c(c2)c2cc4c(cc2n3-c2ccccc2)C(C)(C)c2ccccc2-4)c1 |
| InChI | InChI=1S/C67H50N3O/c1-66(2)57-25-15-12-23-49(57)51-37-55-53-35-41(28-30-62(53)69(64(55)39-59(51)66)46-18-8-6-9-19-46)43-32-44(34-45(33-43)48-22-14-17-27-61(48)68(5)71)42-29-31-63-54(36-42)56-38-52-50-24-13-16-26-58(50)67(3,4)60(52)40-65(56)70(63)47-20-10-7-11-21-47/h6-40H,1-5H3/q+1 |
| InChIKey | YACPTALDEMMIFG-UHFFFAOYSA-N |
| XLogP | 17.53 |
| TPSA | 29.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.16 |
| LogP ≤ 5 | 17.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|