C63H43N7 — CID 164785712
2-[3,5-bis[3-(5-pyrimidin-5-yl-3-pyridinyl)phenyl]phenyl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole (PubChem CID 164785712) has the molecular formula C63H43N7 and a molecular weight of 898.09 g/mol. Its IUPAC name is 2-[3,5-bis[3-(5-pyrimidin-5-yl-3-pyridinyl)phenyl]phenyl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole.
| Compound Name | 2-[3,5-bis[3-(5-pyrimidin-5-yl-3-pyridinyl)phenyl]phenyl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 164785712 |
| Molecular Formula | C63H43N7 |
| Molecular Weight | 898.09 g/mol |
| Exact Mass | 897.36 |
| IUPAC Name | 2-[3,5-bis[3-(5-pyrimidin-5-yl-3-pyridinyl)phenyl]phenyl]-7,7-dimethyl-5-phenylindeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4cc(-c5cc(-c6cccc(-c7cncc(-c8cncnc8)c7)c6)cc(-c6cccc(-c7cncc(-c8cncnc8)c7)c6)c5)ccc4n(-c4ccccc4)c3cc21 |
| InChI | InChI=1S/C63H43N7/c1-63(2)59-17-7-6-16-55(59)56-28-58-57-27-44(18-19-61(57)70(62(58)29-60(56)63)54-14-4-3-5-15-54)47-23-45(40-10-8-12-42(20-40)48-25-50(32-64-30-48)52-34-66-38-67-35-52)22-46(24-47)41-11-9-13-43(21-41)49-26-51(33-65-31-49)53-36-68-39-69-37-53/h3-39H,1-2H3 |
| InChIKey | BIGZRXLCRCEIEO-UHFFFAOYSA-N |
| XLogP | 15.13 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.09 |
| LogP ≤ 5 | 15.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |