C20H20N2 — CID 123249171
4-butyl-3,6-diphenylpyridazine (PubChem CID 123249171) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-butyl-3,6-diphenylpyridazine.
| Compound Name | 4-butyl-3,6-diphenylpyridazine |
|---|---|
| PubChem CID | 123249171 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-butyl-3,6-diphenylpyridazine |
| SMILES | CCCCc1cc(-c2ccccc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C20H20N2/c1-2-3-10-18-15-19(16-11-6-4-7-12-16)21-22-20(18)17-13-8-5-9-14-17/h4-9,11-15H,2-3,10H2,1H3 |
| InChIKey | FQQLHKYUOIVMTD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |