C17H26ClNO5S — CID 123250128
9-[[2-(aminomethyl)phenyl]methylsulfanylmethyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride (PubChem CID 123250128) has the molecular formula C17H26ClNO5S and a molecular weight of 391.92 g/mol. Its IUPAC name is 9-[[2-(aminomethyl)phenyl]methylsulfanylmethyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride.
| Compound Name | 9-[[2-(aminomethyl)phenyl]methylsulfanylmethyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride |
|---|---|
| PubChem CID | 123250128 |
| Molecular Formula | C17H26ClNO5S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 9-[[2-(aminomethyl)phenyl]methylsulfanylmethyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol;hydrochloride |
| SMILES | Cl.NCc1ccccc1CSCC1OC2OCCCOC1C(O)C2O |
| InChI | InChI=1S/C17H25NO5S.ClH/c18-8-11-4-1-2-5-12(11)9-24-10-13-16-14(19)15(20)17(23-13)22-7-3-6-21-16;/h1-2,4-5,13-17,19-20H,3,6-10,18H2;1H |
| InChIKey | JTHFFSNFIQALDX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |