C25H27FN8O — CID 123251207
N-[(3-ethyl-6-fluoro-1H-indol-2-yl)methyl]-9-(furan-3-yl)-2-(4-methylpiperazin-1-yl)purin-6-amine (PubChem CID 123251207) has the molecular formula C25H27FN8O and a molecular weight of 474.54 g/mol. Its IUPAC name is N-[(3-ethyl-6-fluoro-1H-indol-2-yl)methyl]-9-(furan-3-yl)-2-(4-methylpiperazin-1-yl)purin-6-amine.
| Compound Name | N-[(3-ethyl-6-fluoro-1H-indol-2-yl)methyl]-9-(furan-3-yl)-2-(4-methylpiperazin-1-yl)purin-6-amine |
|---|---|
| PubChem CID | 123251207 |
| Molecular Formula | C25H27FN8O |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-[(3-ethyl-6-fluoro-1H-indol-2-yl)methyl]-9-(furan-3-yl)-2-(4-methylpiperazin-1-yl)purin-6-amine |
| SMILES | CCc1c(CNc2nc(N3CCN(C)CC3)nc3c2ncn3-c2ccoc2)[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C25H27FN8O/c1-3-18-19-5-4-16(26)12-20(19)29-21(18)13-27-23-22-24(34(15-28-22)17-6-11-35-14-17)31-25(30-23)33-9-7-32(2)8-10-33/h4-6,11-12,14-15,29H,3,7-10,13H2,1-2H3,(H,27,30,31) |
| InChIKey | NZPLEHOEZHGYTN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|