About 2-amino-N-ethenyl-N'-methylethanimidamide
2-amino-N-ethenyl-N'-methylethanimidamide (PubChem CID 123251387) has the molecular formula C5H11N3
and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-amino-N-ethenyl-N'-methylethanimidamide.
Molecular Properties
| Compound Name | 2-amino-N-ethenyl-N'-methylethanimidamide |
| PubChem CID | 123251387 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 2-amino-N-ethenyl-N'-methylethanimidamide |
| SMILES | C=CN/C(CN)=N/C |
| InChI | InChI=1S/C5H11N3/c1-3-8-5(4-6)7-2/h3H,1,4,6H2,2H3,(H,7,8) |
| InChIKey | HXDMLPXTFRRGGT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-ethenyl-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-ethenyl-N'-methylethanimidamide?
The IUPAC name of 2-amino-N-ethenyl-N'-methylethanimidamide (CID 123251387) is 2-amino-N-ethenyl-N'-methylethanimidamide.
What is the SMILES notation for 2-amino-N-ethenyl-N'-methylethanimidamide?
The canonical SMILES for 2-amino-N-ethenyl-N'-methylethanimidamide is C=CN/C(CN)=N/C.
What is the InChIKey of 2-amino-N-ethenyl-N'-methylethanimidamide?
The InChIKey is HXDMLPXTFRRGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3/c1-3-8-5(4-6)7-2/h3H,1,4,6H2,2H3,(H,7,8).
What are the key properties of 2-amino-N-ethenyl-N'-methylethanimidamide?
2-amino-N-ethenyl-N'-methylethanimidamide has a molecular weight of 113.16 g/mol, XLogP of -0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-ethenyl-N'-methylethanimidamide is sourced from PubChem (CID 123251387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).