C24H27FN4O2 — CID 123252345
1-[2-fluoro-5-[(8-piperidin-4-yloxyquinazolin-2-yl)amino]phenyl]-3-methylbutan-1-one (PubChem CID 123252345) has the molecular formula C24H27FN4O2 and a molecular weight of 422.50 g/mol. Its IUPAC name is 1-[2-fluoro-5-[(8-piperidin-4-yloxyquinazolin-2-yl)amino]phenyl]-3-methylbutan-1-one.
| Compound Name | 1-[2-fluoro-5-[(8-piperidin-4-yloxyquinazolin-2-yl)amino]phenyl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 123252345 |
| Molecular Formula | C24H27FN4O2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-[2-fluoro-5-[(8-piperidin-4-yloxyquinazolin-2-yl)amino]phenyl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)c1cc(Nc2ncc3cccc(OC4CCNCC4)c3n2)ccc1F |
| InChI | InChI=1S/C24H27FN4O2/c1-15(2)12-21(30)19-13-17(6-7-20(19)25)28-24-27-14-16-4-3-5-22(23(16)29-24)31-18-8-10-26-11-9-18/h3-7,13-15,18,26H,8-12H2,1-2H3,(H,27,28,29) |
| InChIKey | FUWZGQUDSZWLPY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |