C25H22FN3O2 — CID 123254660
(5-fluoro-2-pyridin-4-ylphenyl)-[4-hydroxy-4-[(4-isocyanophenyl)methyl]piperidin-1-yl]methanone (PubChem CID 123254660) has the molecular formula C25H22FN3O2 and a molecular weight of 415.47 g/mol. Its IUPAC name is (5-fluoro-2-pyridin-4-ylphenyl)-[4-hydroxy-4-[(4-isocyanophenyl)methyl]piperidin-1-yl]methanone.
| Compound Name | (5-fluoro-2-pyridin-4-ylphenyl)-[4-hydroxy-4-[(4-isocyanophenyl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 123254660 |
| Molecular Formula | C25H22FN3O2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (5-fluoro-2-pyridin-4-ylphenyl)-[4-hydroxy-4-[(4-isocyanophenyl)methyl]piperidin-1-yl]methanone |
| SMILES | [C-]#[N+]c1ccc(CC2(O)CCN(C(=O)c3cc(F)ccc3-c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C25H22FN3O2/c1-27-21-5-2-18(3-6-21)17-25(31)10-14-29(15-11-25)24(30)23-16-20(26)4-7-22(23)19-8-12-28-13-9-19/h2-9,12-13,16,31H,10-11,14-15,17H2 |
| InChIKey | QFWHOLPENWJIHY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 57.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|