C14H19FN2O3 — CID 154766416
2-fluoroethyl 4-hydroxy-4-(pyridin-4-ylmethyl)piperidine-1-carboxylate (PubChem CID 154766416) has the molecular formula C14H19FN2O3 and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-fluoroethyl 4-hydroxy-4-(pyridin-4-ylmethyl)piperidine-1-carboxylate.
| Compound Name | 2-fluoroethyl 4-hydroxy-4-(pyridin-4-ylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154766416 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-fluoroethyl 4-hydroxy-4-(pyridin-4-ylmethyl)piperidine-1-carboxylate |
| SMILES | O=C(OCCF)N1CCC(O)(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C14H19FN2O3/c15-5-10-20-13(18)17-8-3-14(19,4-9-17)11-12-1-6-16-7-2-12/h1-2,6-7,19H,3-5,8-11H2 |
| InChIKey | MYACUHLRWJSGCO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |