About 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate
1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate (PubChem CID 123255713) has the molecular formula C19H26N8OS2
and a molecular weight of 446.61 g/mol. Its IUPAC name is 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate.
Molecular Properties
| Compound Name | 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate |
| PubChem CID | 123255713 |
| Molecular Formula | C19H26N8OS2 |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate |
| SMILES | [H]/N=C(/CCCC/C(=N\[H])SC(N)=NC(O)Cc1cccc(-n2cccn2)c1)S/C(N)=N/[H] |
| InChI | InChI=1S/C19H26N8OS2/c20-15(29-18(22)23)7-1-2-8-16(21)30-19(24)26-17(28)12-13-5-3-6-14(11-13)27-10-4-9-25-27/h3-6,9-11,17,20-21,28H,1-2,7-8,12H2,(H3,22,23)(H2,24,26)/b20-15-,21-16+ |
| InChIKey | BFCDVFNNYRBDOM-MEDLQYOTSA-N |
| XLogP | 2.92 |
| TPSA | 174.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate?
The IUPAC name of 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate (CID 123255713) is 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate.
What is the SMILES notation for 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate?
The canonical SMILES for 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate is [H]/N=C(/CCCC/C(=N\[H])SC(N)=NC(O)Cc1cccc(-n2cccn2)c1)S/C(N)=N/[H].
What is the InChIKey of 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate?
The InChIKey is BFCDVFNNYRBDOM-MEDLQYOTSA-N. The full InChI is InChI=1S/C19H26N8OS2/c20-15(29-18(22)23)7-1-2-8-16(21)30-19(24)26-17(28)12-13-5-3-6-14(11-13)27-10-4-9-25-27/h3-6,9-11,17,20-21,28H,1-2,7-8,12H2,(H3,22,23)(H2,24,26)/b20-15-,21-16+.
What are the key properties of 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate?
1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate has a molecular weight of 446.61 g/mol, XLogP of 2.92, 9 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-S-carbamimidoyl 6-S-[N'-[1-hydroxy-2-(3-pyrazol-1-ylphenyl)ethyl]carbamimidoyl] hexanediimidothioate is sourced from PubChem (CID 123255713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).