C14H13ClO3S — CID 123256939
2-[3-chloro-4-[(3-oxothiolan-2-ylidene)methyl]phenyl]propanoic acid (PubChem CID 123256939) has the molecular formula C14H13ClO3S and a molecular weight of 296.78 g/mol. Its IUPAC name is 2-[3-chloro-4-[(3-oxothiolan-2-ylidene)methyl]phenyl]propanoic acid.
| Compound Name | 2-[3-chloro-4-[(3-oxothiolan-2-ylidene)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123256939 |
| Molecular Formula | C14H13ClO3S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-[3-chloro-4-[(3-oxothiolan-2-ylidene)methyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(C=C2SCCC2=O)c(Cl)c1 |
| InChI | InChI=1S/C14H13ClO3S/c1-8(14(17)18)9-2-3-10(11(15)6-9)7-13-12(16)4-5-19-13/h2-3,6-8H,4-5H2,1H3,(H,17,18) |
| InChIKey | YKHOZAGNGGFXRL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|