C14H17ClO3S — CID 174598240
2-[3-chloro-4-[(3-hydroxythiolan-2-yl)methyl]phenyl]propanoic acid (PubChem CID 174598240) has the molecular formula C14H17ClO3S and a molecular weight of 300.81 g/mol. Its IUPAC name is 2-[3-chloro-4-[(3-hydroxythiolan-2-yl)methyl]phenyl]propanoic acid.
| Compound Name | 2-[3-chloro-4-[(3-hydroxythiolan-2-yl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 174598240 |
| Molecular Formula | C14H17ClO3S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[3-chloro-4-[(3-hydroxythiolan-2-yl)methyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(CC2SCCC2O)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClO3S/c1-8(14(17)18)9-2-3-10(11(15)6-9)7-13-12(16)4-5-19-13/h2-3,6,8,12-13,16H,4-5,7H2,1H3,(H,17,18) |
| InChIKey | ZGXJPQBAEIKOIK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |