C19H24N3O2+ — CID 123257114
1-[4-(1-hydroxy-2-methylquinolin-1-ium-4-yl)piperazin-1-yl]pent-2-en-1-one (PubChem CID 123257114) has the molecular formula C19H24N3O2+ and a molecular weight of 326.42 g/mol. Its IUPAC name is 1-[4-(1-hydroxy-2-methylquinolin-1-ium-4-yl)piperazin-1-yl]pent-2-en-1-one.
| Compound Name | 1-[4-(1-hydroxy-2-methylquinolin-1-ium-4-yl)piperazin-1-yl]pent-2-en-1-one |
|---|---|
| PubChem CID | 123257114 |
| Molecular Formula | C19H24N3O2+ |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-[4-(1-hydroxy-2-methylquinolin-1-ium-4-yl)piperazin-1-yl]pent-2-en-1-one |
| SMILES | CCC=CC(=O)N1CCN(c2cc(C)[n+](O)c3ccccc23)CC1 |
| InChI | InChI=1S/C19H24N3O2/c1-3-4-9-19(23)21-12-10-20(11-13-21)18-14-15(2)22(24)17-8-6-5-7-16(17)18/h4-9,14,24H,3,10-13H2,1-2H3/q+1 |
| InChIKey | BWVWAVLXVUZZDQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 47.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|