C12H15Cl3N3O2P — CID 123257757
1-cyclohexyl-5H-pyrazolo[5,4-b]pyridin-4-one;phosphoryl trichloride (PubChem CID 123257757) has the molecular formula C12H15Cl3N3O2P and a molecular weight of 370.60 g/mol. Its IUPAC name is 1-cyclohexyl-5H-pyrazolo[5,4-b]pyridin-4-one;phosphoryl trichloride.
| Compound Name | 1-cyclohexyl-5H-pyrazolo[5,4-b]pyridin-4-one;phosphoryl trichloride |
|---|---|
| PubChem CID | 123257757 |
| Molecular Formula | C12H15Cl3N3O2P |
| Molecular Weight | 370.60 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 1-cyclohexyl-5H-pyrazolo[5,4-b]pyridin-4-one;phosphoryl trichloride |
| SMILES | O=C1CC=Nc2c1cnn2C1CCCCC1.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H15N3O.Cl3OP/c16-11-6-7-13-12-10(11)8-14-15(12)9-4-2-1-3-5-9;1-5(2,3)4/h7-9H,1-6H2; |
| InChIKey | HRKHYUXKZZMWJN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|