C14H24Cl2N2O — CID 173110964
4,5-dichloro-2-cyclooctylpyridazin-3-one;methane (PubChem CID 173110964) has the molecular formula C14H24Cl2N2O and a molecular weight of 307.26 g/mol. Its IUPAC name is 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane.
| Compound Name | 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane |
|---|---|
| PubChem CID | 173110964 |
| Molecular Formula | C14H24Cl2N2O |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane |
| SMILES | C.C.O=c1c(Cl)c(Cl)cnn1C1CCCCCCC1 |
| InChI | InChI=1S/C12H16Cl2N2O.2CH4/c13-10-8-15-16(12(17)11(10)14)9-6-4-2-1-3-5-7-9;;/h8-9H,1-7H2;2*1H4 |
| InChIKey | CHVYMRBRSFHFGN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |