About 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane
4,5-dichloro-2-cyclooctylpyridazin-3-one;methane (PubChem CID 173110964) has the molecular formula C14H24Cl2N2O
and a molecular weight of 307.26 g/mol. Its IUPAC name is 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane.
Molecular Properties
| Compound Name | 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane |
| PubChem CID | 173110964 |
| Molecular Formula | C14H24Cl2N2O |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane |
| SMILES | C.C.O=c1c(Cl)c(Cl)cnn1C1CCCCCCC1 |
| InChI | InChI=1S/C12H16Cl2N2O.2CH4/c13-10-8-15-16(12(17)11(10)14)9-6-4-2-1-3-5-7-9;;/h8-9H,1-7H2;2*1H4 |
| InChIKey | CHVYMRBRSFHFGN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane?
The IUPAC name of 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane (CID 173110964) is 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane.
What is the SMILES notation for 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane?
The canonical SMILES for 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane is C.C.O=c1c(Cl)c(Cl)cnn1C1CCCCCCC1.
What is the InChIKey of 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane?
The InChIKey is CHVYMRBRSFHFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Cl2N2O.2CH4/c13-10-8-15-16(12(17)11(10)14)9-6-4-2-1-3-5-7-9;;/h8-9H,1-7H2;2*1H4.
What are the key properties of 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane?
4,5-dichloro-2-cyclooctylpyridazin-3-one;methane has a molecular weight of 307.26 g/mol, XLogP of 5.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-cyclooctylpyridazin-3-one;methane is sourced from PubChem (CID 173110964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).