C17H18Cl2FN3O2 — CID 171823808
4,5-dichloro-2-[4-[4-(fluoromethoxy)anilino]cyclohexyl]pyridazin-3-one (PubChem CID 171823808) has the molecular formula C17H18Cl2FN3O2 and a molecular weight of 386.25 g/mol. Its IUPAC name is 4,5-dichloro-2-[4-[4-(fluoromethoxy)anilino]cyclohexyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[4-[4-(fluoromethoxy)anilino]cyclohexyl]pyridazin-3-one |
|---|---|
| PubChem CID | 171823808 |
| Molecular Formula | C17H18Cl2FN3O2 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 4,5-dichloro-2-[4-[4-(fluoromethoxy)anilino]cyclohexyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1C1CCC(Nc2ccc(OCF)cc2)CC1 |
| InChI | InChI=1S/C17H18Cl2FN3O2/c18-15-9-21-23(17(24)16(15)19)13-5-1-11(2-6-13)22-12-3-7-14(8-4-12)25-10-20/h3-4,7-9,11,13,22H,1-2,5-6,10H2 |
| InChIKey | ORMOEDHENWXKOA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|