C20H34N2O4 — CID 123259139
(3S,7aS)-3-tert-butyl-N-nonyl-5,7-dioxo-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide (PubChem CID 123259139) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is (3S,7aS)-3-tert-butyl-N-nonyl-5,7-dioxo-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide.
| Compound Name | (3S,7aS)-3-tert-butyl-N-nonyl-5,7-dioxo-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide |
|---|---|
| PubChem CID | 123259139 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | (3S,7aS)-3-tert-butyl-N-nonyl-5,7-dioxo-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide |
| SMILES | CCCCCCCCCNC(=O)C1C(=O)[C@@H]2CO[C@@H](C(C)(C)C)N2C1=O |
| InChI | InChI=1S/C20H34N2O4/c1-5-6-7-8-9-10-11-12-21-17(24)15-16(23)14-13-26-19(20(2,3)4)22(14)18(15)25/h14-15,19H,5-13H2,1-4H3,(H,21,24)/t14-,15?,19-/m0/s1 |
| InChIKey | CSYOUJDXNWOKSK-OCGXIWQUSA-N |
| XLogP | 2.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|