C12H18N2O4 — CID 123983154
(1R,3R,7aR)-3-tert-butyl-1-methyl-5,7-dioxo-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide (PubChem CID 123983154) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is (1R,3R,7aR)-3-tert-butyl-1-methyl-5,7-dioxo-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide.
| Compound Name | (1R,3R,7aR)-3-tert-butyl-1-methyl-5,7-dioxo-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide |
|---|---|
| PubChem CID | 123983154 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (1R,3R,7aR)-3-tert-butyl-1-methyl-5,7-dioxo-3,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6-carboxamide |
| SMILES | C[C@H]1O[C@H](C(C)(C)C)N2C(=O)C(C(N)=O)C(=O)[C@@H]12 |
| InChI | InChI=1S/C12H18N2O4/c1-5-7-8(15)6(9(13)16)10(17)14(7)11(18-5)12(2,3)4/h5-7,11H,1-4H3,(H2,13,16)/t5-,6?,7-,11-/m1/s1 |
| InChIKey | KARAJOBKCBSFQD-MRYPEJKBSA-N |
| XLogP | -0.34 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|