C6H18N2OSi — CID 123259159
N'-[2-[hydroxy(methyl)silyl]ethyl]propane-1,3-diamine (PubChem CID 123259159) has the molecular formula C6H18N2OSi and a molecular weight of 162.31 g/mol. Its IUPAC name is N'-[2-[hydroxy(methyl)silyl]ethyl]propane-1,3-diamine.
| Compound Name | N'-[2-[hydroxy(methyl)silyl]ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 123259159 |
| Molecular Formula | C6H18N2OSi |
| Molecular Weight | 162.31 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N'-[2-[hydroxy(methyl)silyl]ethyl]propane-1,3-diamine |
| SMILES | C[SiH](O)CCNCCCN |
| InChI | InChI=1S/C6H18N2OSi/c1-10(9)6-5-8-4-2-3-7/h8-10H,2-7H2,1H3 |
| InChIKey | ZMSLWFKMNFBWPD-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|