About 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine
7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine (PubChem CID 123260315) has the molecular formula C7H8N3+
and a molecular weight of 134.16 g/mol. Its IUPAC name is 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine.
Molecular Properties
| Compound Name | 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine |
| PubChem CID | 123260315 |
| Molecular Formula | C7H8N3+ |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine |
| SMILES | Nc1ncc[n+]2c1=CCC=2 |
| InChI | InChI=1S/C7H8N3/c8-7-6-2-1-4-10(6)5-3-9-7/h2-5H,1H2,(H2,8,9)/q+1 |
| InChIKey | PUCFTURRAKFKLR-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine?
The IUPAC name of 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine (CID 123260315) is 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine.
What is the SMILES notation for 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine?
The canonical SMILES for 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine is Nc1ncc[n+]2c1=CCC=2.
What is the InChIKey of 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine?
The InChIKey is PUCFTURRAKFKLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N3/c8-7-6-2-1-4-10(6)5-3-9-7/h2-5H,1H2,(H2,8,9)/q+1.
What are the key properties of 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine?
7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine has a molecular weight of 134.16 g/mol, XLogP of -0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-pyrrolo[1,2-a]pyrazin-5-ium-1-amine is sourced from PubChem (CID 123260315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).