About 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium
3-methyl-6H-imidazo[4,5-b]pyridin-4-ium (PubChem CID 56990879) has the molecular formula C7H8N3+
and a molecular weight of 134.16 g/mol. Its IUPAC name is 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium.
Molecular Properties
| Compound Name | 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium |
| PubChem CID | 56990879 |
| Molecular Formula | C7H8N3+ |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium |
| SMILES | Cn1cnc2c1=[N+]=CCC=2 |
| InChI | InChI=1S/C7H8N3/c1-10-5-9-6-3-2-4-8-7(6)10/h3-5H,2H2,1H3/q+1 |
| InChIKey | ZHDNLINKJHTIGU-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 31.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium?
The IUPAC name of 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium (CID 56990879) is 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium.
What is the SMILES notation for 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium?
The canonical SMILES for 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium is Cn1cnc2c1=[N+]=CCC=2.
What is the InChIKey of 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium?
The InChIKey is ZHDNLINKJHTIGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N3/c1-10-5-9-6-3-2-4-8-7(6)10/h3-5H,2H2,1H3/q+1.
What are the key properties of 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium?
3-methyl-6H-imidazo[4,5-b]pyridin-4-ium has a molecular weight of 134.16 g/mol, XLogP of -1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6H-imidazo[4,5-b]pyridin-4-ium is sourced from PubChem (CID 56990879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).