C11H11ClN2O5 — CID 123260671
1-[3-(2-chloroethynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 123260671) has the molecular formula C11H11ClN2O5 and a molecular weight of 286.67 g/mol. Its IUPAC name is 1-[3-(2-chloroethynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-(2-chloroethynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123260671 |
| Molecular Formula | C11H11ClN2O5 |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1-[3-(2-chloroethynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C2OC(CO)C(O)C2C#CCl)c(=O)[nH]1 |
| InChI | InChI=1S/C11H11ClN2O5/c12-3-1-6-9(17)7(5-15)19-10(6)14-4-2-8(16)13-11(14)18/h2,4,6-7,9-10,15,17H,5H2,(H,13,16,18) |
| InChIKey | KZIJXNWOKILDLX-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|