C28H34O5 — CID 123260799
[2-(2-formylbenzoyl)-4-octanoylphenyl] 3,3-dimethylbutanoate (PubChem CID 123260799) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is [2-(2-formylbenzoyl)-4-octanoylphenyl] 3,3-dimethylbutanoate.
| Compound Name | [2-(2-formylbenzoyl)-4-octanoylphenyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 123260799 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | [2-(2-formylbenzoyl)-4-octanoylphenyl] 3,3-dimethylbutanoate |
| SMILES | CCCCCCCC(=O)c1ccc(OC(=O)CC(C)(C)C)c(C(=O)c2ccccc2C=O)c1 |
| InChI | InChI=1S/C28H34O5/c1-5-6-7-8-9-14-24(30)20-15-16-25(33-26(31)18-28(2,3)4)23(17-20)27(32)22-13-11-10-12-21(22)19-29/h10-13,15-17,19H,5-9,14,18H2,1-4H3 |
| InChIKey | KBBWSNLLPWYSKM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|