C40H54O10 — CID 53252720
[2-[2-(3-methylbutanoyloxy)-5-octanoylbenzoyl]peroxycarbonyl-4-octanoylphenyl] 3-methylbutanoate (PubChem CID 53252720) has the molecular formula C40H54O10 and a molecular weight of 694.86 g/mol. Its IUPAC name is [2-[2-(3-methylbutanoyloxy)-5-octanoylbenzoyl]peroxycarbonyl-4-octanoylphenyl] 3-methylbutanoate.
| Compound Name | [2-[2-(3-methylbutanoyloxy)-5-octanoylbenzoyl]peroxycarbonyl-4-octanoylphenyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 53252720 |
| Molecular Formula | C40H54O10 |
| Molecular Weight | 694.86 g/mol |
| Exact Mass | 694.37 |
| IUPAC Name | [2-[2-(3-methylbutanoyloxy)-5-octanoylbenzoyl]peroxycarbonyl-4-octanoylphenyl] 3-methylbutanoate |
| SMILES | CCCCCCCC(=O)c1ccc(OC(=O)CC(C)C)c(C(=O)OOC(=O)c2cc(C(=O)CCCCCCC)ccc2OC(=O)CC(C)C)c1 |
| InChI | InChI=1S/C40H54O10/c1-7-9-11-13-15-17-33(41)29-19-21-35(47-37(43)23-27(3)4)31(25-29)39(45)49-50-40(46)32-26-30(34(42)18-16-14-12-10-8-2)20-22-36(32)48-38(44)24-28(5)6/h19-22,25-28H,7-18,23-24H2,1-6H3 |
| InChIKey | GBZGCHRDGFWSGS-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.86 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|