C33H44O7 — CID 174668186
benzoyl 2-(3-ethyl-4-oxononan-5-yl)oxy-5-octanoylbenzenecarboperoxoate (PubChem CID 174668186) has the molecular formula C33H44O7 and a molecular weight of 552.71 g/mol. Its IUPAC name is benzoyl 2-(3-ethyl-4-oxononan-5-yl)oxy-5-octanoylbenzenecarboperoxoate.
| Compound Name | benzoyl 2-(3-ethyl-4-oxononan-5-yl)oxy-5-octanoylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 174668186 |
| Molecular Formula | C33H44O7 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | benzoyl 2-(3-ethyl-4-oxononan-5-yl)oxy-5-octanoylbenzenecarboperoxoate |
| SMILES | CCCCCCCC(=O)c1ccc(OC(CCCC)C(=O)C(CC)CC)c(C(=O)OOC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C33H44O7/c1-5-9-11-12-16-19-28(34)26-21-22-29(38-30(20-10-6-2)31(35)24(7-3)8-4)27(23-26)33(37)40-39-32(36)25-17-14-13-15-18-25/h13-15,17-18,21-24,30H,5-12,16,19-20H2,1-4H3 |
| InChIKey | LXYYVZGKVDLHEW-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|