C11H16FNO — CID 123261031
1-(5-fluorohexa-1,3,5-trien-3-yl)piperidin-4-ol (PubChem CID 123261031) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is 1-(5-fluorohexa-1,3,5-trien-3-yl)piperidin-4-ol.
| Compound Name | 1-(5-fluorohexa-1,3,5-trien-3-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 123261031 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-(5-fluorohexa-1,3,5-trien-3-yl)piperidin-4-ol |
| SMILES | C=CC(=CC(=C)F)N1CCC(O)CC1 |
| InChI | InChI=1S/C11H16FNO/c1-3-10(8-9(2)12)13-6-4-11(14)5-7-13/h3,8,11,14H,1-2,4-7H2 |
| InChIKey | GFGCRGNIAUCLEQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|