C29H25Cl2N3O2 — CID 123263282
4-[4-[4-(2-aminopropan-2-yl)anilino]-3-(cyclopropanecarbonyl)quinolin-6-yl]-2,6-dichlorobenzaldehyde (PubChem CID 123263282) has the molecular formula C29H25Cl2N3O2 and a molecular weight of 518.44 g/mol. Its IUPAC name is 4-[4-[4-(2-aminopropan-2-yl)anilino]-3-(cyclopropanecarbonyl)quinolin-6-yl]-2,6-dichlorobenzaldehyde.
| Compound Name | 4-[4-[4-(2-aminopropan-2-yl)anilino]-3-(cyclopropanecarbonyl)quinolin-6-yl]-2,6-dichlorobenzaldehyde |
|---|---|
| PubChem CID | 123263282 |
| Molecular Formula | C29H25Cl2N3O2 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 4-[4-[4-(2-aminopropan-2-yl)anilino]-3-(cyclopropanecarbonyl)quinolin-6-yl]-2,6-dichlorobenzaldehyde |
| SMILES | CC(C)(N)c1ccc(Nc2c(C(=O)C3CC3)cnc3ccc(-c4cc(Cl)c(C=O)c(Cl)c4)cc23)cc1 |
| InChI | InChI=1S/C29H25Cl2N3O2/c1-29(2,32)19-6-8-20(9-7-19)34-27-21-11-17(18-12-24(30)23(15-35)25(31)13-18)5-10-26(21)33-14-22(27)28(36)16-3-4-16/h5-16H,3-4,32H2,1-2H3,(H,33,34) |
| InChIKey | XBCNZYWZQOFBAR-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|