C25H20ClN3O4 — CID 66715099
4-[[3-acetyl-6-(3-chloro-4-hydroxy-5-methoxyphenyl)quinolin-4-yl]amino]benzamide (PubChem CID 66715099) has the molecular formula C25H20ClN3O4 and a molecular weight of 461.91 g/mol. Its IUPAC name is 4-[[3-acetyl-6-(3-chloro-4-hydroxy-5-methoxyphenyl)quinolin-4-yl]amino]benzamide.
| Compound Name | 4-[[3-acetyl-6-(3-chloro-4-hydroxy-5-methoxyphenyl)quinolin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 66715099 |
| Molecular Formula | C25H20ClN3O4 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 4-[[3-acetyl-6-(3-chloro-4-hydroxy-5-methoxyphenyl)quinolin-4-yl]amino]benzamide |
| SMILES | COc1cc(-c2ccc3ncc(C(C)=O)c(Nc4ccc(C(N)=O)cc4)c3c2)cc(Cl)c1O |
| InChI | InChI=1S/C25H20ClN3O4/c1-13(30)19-12-28-21-8-5-15(16-10-20(26)24(31)22(11-16)33-2)9-18(21)23(19)29-17-6-3-14(4-7-17)25(27)32/h3-12,31H,1-2H3,(H2,27,32)(H,28,29) |
| InChIKey | CSFBQJGWYSZHEA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |