C57H58Cl2N10O5 — CID 175278654
2,4-bis[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]quinolin-3-yl]pentan-3-one (PubChem CID 175278654) has the molecular formula C57H58Cl2N10O5 and a molecular weight of 1034.06 g/mol. Its IUPAC name is 2,4-bis[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]quinolin-3-yl]pentan-3-one.
| Compound Name | 2,4-bis[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]quinolin-3-yl]pentan-3-one |
|---|---|
| PubChem CID | 175278654 |
| Molecular Formula | C57H58Cl2N10O5 |
| Molecular Weight | 1034.06 g/mol |
| Exact Mass | 1032.40 |
| IUPAC Name | 2,4-bis[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-4-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]amino]quinolin-3-yl]pentan-3-one |
| SMILES | COc1cc(-c2ccc3ncc(C(C)C(=O)C(C)c4cnc5ccc(-c6cc(Cl)c(O)c(OC)c6)cc5c4Nc4ccc(N5CCN(C)CC5)nc4)c(Nc4ccc(N5CCN(C)CC5)nc4)c3c2)cc(Cl)c1O |
| InChI | InChI=1S/C57H58Cl2N10O5/c1-33(43-31-60-47-11-7-35(37-25-45(58)56(71)49(27-37)73-5)23-41(47)53(43)64-39-9-13-51(62-29-39)68-19-15-66(3)16-20-68)55(70)34(2)44-32-61-48-12-8-36(38-26-46(59)57(72)50(28-38)74-6)24-42(48)54(44)65-40-10-14-52(63-30-40)69-21-17-67(4)18-22-69/h7-14,23-34,71-72H,15-22H2,1-6H3,(H,60,64)(H,61,65) |
| InChIKey | CIGZVNRTXXTMIH-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 164.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1034.06 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |