C18H25N3O2 — CID 123264977
2-(azetidin-3-ylmethyl)-N-(2-methoxyethyl)-6-methyl-3H-isoquinoline-7-carboxamide (PubChem CID 123264977) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-(azetidin-3-ylmethyl)-N-(2-methoxyethyl)-6-methyl-3H-isoquinoline-7-carboxamide.
| Compound Name | 2-(azetidin-3-ylmethyl)-N-(2-methoxyethyl)-6-methyl-3H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 123264977 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-(azetidin-3-ylmethyl)-N-(2-methoxyethyl)-6-methyl-3H-isoquinoline-7-carboxamide |
| SMILES | COCCNC(=O)c1cc2c(cc1C)=CCN(CC1CNC1)C=2 |
| InChI | InChI=1S/C18H25N3O2/c1-13-7-15-3-5-21(11-14-9-19-10-14)12-16(15)8-17(13)18(22)20-4-6-23-2/h3,7-8,12,14,19H,4-6,9-11H2,1-2H3,(H,20,22) |
| InChIKey | RCALMJSJAKWOQC-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|