C19H24F3N3O2 — CID 123788739
2-(azetidin-3-ylmethyl)-8-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3H-isoquinoline-7-carboxamide (PubChem CID 123788739) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-(azetidin-3-ylmethyl)-8-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3H-isoquinoline-7-carboxamide.
| Compound Name | 2-(azetidin-3-ylmethyl)-8-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 123788739 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-(azetidin-3-ylmethyl)-8-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3H-isoquinoline-7-carboxamide |
| SMILES | Cc1c(C(=O)NCCOCC(F)(F)F)ccc2c1=CN(CC1CNC1)CC=2 |
| InChI | InChI=1S/C19H24F3N3O2/c1-13-16(18(26)24-5-7-27-12-19(20,21)22)3-2-15-4-6-25(11-17(13)15)10-14-8-23-9-14/h2-4,11,14,23H,5-10,12H2,1H3,(H,24,26) |
| InChIKey | VBJRZDJQKHHPLE-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|