C23H28F2N2O2 — CID 123863199
2-(cyclohex-3-en-1-ylmethyl)-N-[2-(1,1-difluoropropoxy)ethyl]-6-methylisoquinoline-7-carboxamide (PubChem CID 123863199) has the molecular formula C23H28F2N2O2 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-(cyclohex-3-en-1-ylmethyl)-N-[2-(1,1-difluoropropoxy)ethyl]-6-methylisoquinoline-7-carboxamide.
| Compound Name | 2-(cyclohex-3-en-1-ylmethyl)-N-[2-(1,1-difluoropropoxy)ethyl]-6-methylisoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 123863199 |
| Molecular Formula | C23H28F2N2O2 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-(cyclohex-3-en-1-ylmethyl)-N-[2-(1,1-difluoropropoxy)ethyl]-6-methylisoquinoline-7-carboxamide |
| SMILES | CCC(F)(F)OCCNC(=O)c1cc2c(cc1C)=C=CN(CC1CC=CCC1)C=2 |
| InChI | InChI=1S/C23H28F2N2O2/c1-3-23(24,25)29-12-10-26-22(28)21-14-20-16-27(11-9-19(20)13-17(21)2)15-18-7-5-4-6-8-18/h4-5,11,13-14,16,18H,3,6-8,10,12,15H2,1-2H3,(H,26,28) |
| InChIKey | RYCABHZBAZBREZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|