About 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one
5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one (PubChem CID 163237705) has the molecular formula C15H21F2N3O2
and a molecular weight of 313.35 g/mol. Its IUPAC name is 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one |
| PubChem CID | 163237705 |
| Molecular Formula | C15H21F2N3O2 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(C2CNCCC2(F)F)cc1CN1CCOCC1 |
| InChI | InChI=1S/C15H21F2N3O2/c16-15(17)1-2-18-9-13(15)11-7-12(14(21)19-8-11)10-20-3-5-22-6-4-20/h7-8,13,18H,1-6,9-10H2,(H,19,21) |
| InChIKey | KVBGIGXQTHWFFN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one?
The IUPAC name of 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one (CID 163237705) is 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one.
What is the SMILES notation for 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one?
The canonical SMILES for 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one is O=c1[nH]cc(C2CNCCC2(F)F)cc1CN1CCOCC1.
What is the InChIKey of 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one?
The InChIKey is KVBGIGXQTHWFFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2N3O2/c16-15(17)1-2-18-9-13(15)11-7-12(14(21)19-8-11)10-20-3-5-22-6-4-20/h7-8,13,18H,1-6,9-10H2,(H,19,21).
What are the key properties of 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one?
5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one has a molecular weight of 313.35 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-difluoropiperidin-3-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one is sourced from PubChem (CID 163237705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).