C20H29F2LiN2O4-2 — CID 176950729
lithium;5-(3,3-difluoropentan-2-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one;(2-methylpropan-2-yl)oxymethanone (PubChem CID 176950729) has the molecular formula C20H29F2LiN2O4-2 and a molecular weight of 406.40 g/mol. Its IUPAC name is lithium;5-(3,3-difluoropentan-2-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one;(2-methylpropan-2-yl)oxymethanone.
| Compound Name | lithium;5-(3,3-difluoropentan-2-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one;(2-methylpropan-2-yl)oxymethanone |
|---|---|
| PubChem CID | 176950729 |
| Molecular Formula | C20H29F2LiN2O4-2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | lithium;5-(3,3-difluoropentan-2-yl)-3-(morpholin-4-ylmethyl)-1H-pyridin-2-one;(2-methylpropan-2-yl)oxymethanone |
| SMILES | CC(C)(C)O[C-]=O.[CH2-]CC(F)(F)C([CH2-])c1c[nH]c(=O)c(CN2CCOCC2)c1.[Li+] |
| InChI | InChI=1S/C15H20F2N2O2.C5H9O2.Li/c1-3-15(16,17)11(2)12-8-13(14(20)18-9-12)10-19-4-6-21-7-5-19;1-5(2,3)7-4-6;/h8-9,11H,1-7,10H2,(H,18,20);1-3H3;/q-2;-1;+1 |
| InChIKey | MGYCMMMYUPWDHU-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|