C23H31F3N2O2 — CID 123290315
1-methyl-7-(2-piperidin-4-ylethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydronaphthalene-2-carboxamide (PubChem CID 123290315) has the molecular formula C23H31F3N2O2 and a molecular weight of 424.51 g/mol. Its IUPAC name is 1-methyl-7-(2-piperidin-4-ylethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydronaphthalene-2-carboxamide.
| Compound Name | 1-methyl-7-(2-piperidin-4-ylethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 123290315 |
| Molecular Formula | C23H31F3N2O2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-methyl-7-(2-piperidin-4-ylethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-6,7-dihydronaphthalene-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCOCC(F)(F)F)ccc2c1=CC(CCC1CCNCC1)CC=2 |
| InChI | InChI=1S/C23H31F3N2O2/c1-16-20(22(29)28-12-13-30-15-23(24,25)26)7-6-19-5-4-18(14-21(16)19)3-2-17-8-10-27-11-9-17/h5-7,14,17-18,27H,2-4,8-13,15H2,1H3,(H,28,29) |
| InChIKey | AFCJTFVHGXJEQN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|