C26H35F3N2O2 — CID 123470707
2-(cyclooct-4-en-1-ylmethyl)-3,9-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2-benzazepine-8-carboxamide (PubChem CID 123470707) has the molecular formula C26H35F3N2O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-(cyclooct-4-en-1-ylmethyl)-3,9-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2-benzazepine-8-carboxamide.
| Compound Name | 2-(cyclooct-4-en-1-ylmethyl)-3,9-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2-benzazepine-8-carboxamide |
|---|---|
| PubChem CID | 123470707 |
| Molecular Formula | C26H35F3N2O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 2-(cyclooct-4-en-1-ylmethyl)-3,9-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2-benzazepine-8-carboxamide |
| SMILES | Cc1c(C(=O)NCCOCC(F)(F)F)ccc2c1=CN(CC1CCC=CCCC1)C(C)CC=2 |
| InChI | InChI=1S/C26H35F3N2O2/c1-19-10-11-22-12-13-23(25(32)30-14-15-33-18-26(27,28)29)20(2)24(22)17-31(19)16-21-8-6-4-3-5-7-9-21/h3-4,11-13,17,19,21H,5-10,14-16,18H2,1-2H3,(H,30,32) |
| InChIKey | DSHFFYXRIFNWCS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|