C24H41N5O4 — CID 123265510
methyl N-[1-[2-[N-[3-ethylidene-4-(ethylideneamino)oxy-5-methylhex-1-en-2-yl]-N'-methylcarbamimidoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 123265510) has the molecular formula C24H41N5O4 and a molecular weight of 463.62 g/mol. Its IUPAC name is methyl N-[1-[2-[N-[3-ethylidene-4-(ethylideneamino)oxy-5-methylhex-1-en-2-yl]-N'-methylcarbamimidoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[1-[2-[N-[3-ethylidene-4-(ethylideneamino)oxy-5-methylhex-1-en-2-yl]-N'-methylcarbamimidoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123265510 |
| Molecular Formula | C24H41N5O4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | methyl N-[1-[2-[N-[3-ethylidene-4-(ethylideneamino)oxy-5-methylhex-1-en-2-yl]-N'-methylcarbamimidoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C=C(N/C(=N\C)C1CCCN1C(=O)C(NC(=O)OC)C(C)C)C(=CC)C(ON=CC)C(C)C |
| InChI | InChI=1S/C24H41N5O4/c1-10-18(21(16(5)6)33-26-11-2)17(7)27-22(25-8)19-13-12-14-29(19)23(30)20(15(3)4)28-24(31)32-9/h10-11,15-16,19-21H,7,12-14H2,1-6,8-9H3,(H,25,27)(H,28,31) |
| InChIKey | HAEYVNCPUGRADV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|