C9H15NO — CID 123265532
2-cyclohexa-1,5-dien-1-yl-2-(methylamino)ethanol (PubChem CID 123265532) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)ethanol.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 123265532 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-2-(methylamino)ethanol |
| SMILES | CNC(CO)C1=CCCC=C1 |
| InChI | InChI=1S/C9H15NO/c1-10-9(7-11)8-5-3-2-4-6-8/h3,5-6,9-11H,2,4,7H2,1H3 |
| InChIKey | XISMMRUAZAQFEE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |